상품명칭 |
2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
별명 |
2,5-Dimethylpyrrole-3-carboxylic acid; 2,5-dimethyl-1H-pyrrole-3-carboxylate |
분자식 |
C7H8NO2 |
분자량 |
138.1445 |
InChI |
InChI=1/C7H9NO2/c1-4-3-6(7(9)10)5(2)8-4/h3,8H,1-2H3,(H,9,10)/p-1 |
cas번호 |
57338-76-8 |
분자 구조 |
|
녹는 점 |
200℃ |
비등점 |
318.4°C at 760 mmHg |
인화점 |
146.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|