product Name |
5-Fluoro-1,2,3-tribromobenzene |
Synonyms |
1,2,3-Tribromo-5-fluorobenzene |
Molecular Formula |
C6H2Br3F |
Molecular Weight |
332.7905 |
InChI |
InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
CAS Registry Number |
576-82-9 |
Molecular Structure |
|
Density |
2.34g/cm3 |
Boiling point |
274.2°C at 760 mmHg |
Refractive index |
1.61 |
Flash point |
119.6°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|