product Name |
1,2-Diphenyl-1,2-ethanediol (meso) |
Synonyms |
meso-Hydrobenzoin; meso-1,2-Diphenyl-1,2-ethanediol; (1R,2S)-1,2-diphenylethane-1,2-diol |
Molecular Formula |
C14H14O2 |
Molecular Weight |
214.2598 |
InChI |
InChI=1/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14+ |
CAS Registry Number |
579-43-1 |
EINECS |
207-758-3 |
Molecular Structure |
|
Density |
1.193g/cm3 |
Melting point |
134-137℃ |
Boiling point |
373°C at 760 mmHg |
Refractive index |
1.624 |
Flash point |
179.8°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|