نام محصول |
tributyl orthoformate |
مترادف |
1-(Dibutoxymethoxy)butane; 1,1',1''-(Methylidynetris(oxy))tributane; Butane, 1,1',1''-(methylidynetris(oxy))tris-; butane, 1,1',1''-[methylidynetris(oxy)]tris-; Orthoformic acid, tributyl ester; Orthoformic acid, tributyl ester (8CI) |
میدان مغناطیسی |
C13H28O3 |
وزن مولکولی |
232.3596 |
InChI |
InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
شماره سیایاس |
588-43-2 |
تعداد کمیسیون اروپایی |
209-618-7 |
ساختار مولکولی |
|
تراکم |
0.884g/cm3 |
نقطه غلیان |
262.7°C at 760 mmHg |
ضریب شکست |
1.427 |
نقطه اشتعال |
96.3°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|