Nome del prodotto |
4-Bromobenzyl chloride |
Sinonimi |
4-Bromo-alpha-chlorotoluene; 1-Bromo-4-(chloromethyl)-benzene; p-Bromobenzyl chloride |
Formula molecolare |
C7H6BrCl |
Peso Molecolare |
205.4795 |
InChI |
InChI=1/C7H6BrCl/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2 |
Numero CAS |
589-17-3 |
EINECS |
209-638-6 |
Struttura molecolare |
|
Densità |
1.541g/cm3 |
Punto di fusione |
36-40℃ |
Punto di ebollizione |
236°C at 760 mmHg |
Indice di rifrazione |
1.569 |
Punto d'infiammabilità |
111.7°C |
Simboli di pericolo |
C:Corrosive;
|
Codici di Rischio |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Sicurezza Descrizione |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|