Nome del prodotto |
4-Methylcyclohexanol, mixture of cis and trans |
Sinonimi |
4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
Formula molecolare |
C7H14O |
Peso Molecolare |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
Numero CAS |
589-91-3 |
EINECS |
209-664-8 |
Struttura molecolare |
|
Densità |
0.925g/cm3 |
Punto di fusione |
-41℃ |
Punto di ebollizione |
170.322°C at 760 mmHg |
Indice di rifrazione |
1.463 |
Punto d'infiammabilità |
70°C |
Solubilità in acqua |
slightly soluble |
Sicurezza Descrizione |
S24/25:;
|
|