نام محصول |
4-phenoxyphenyl isocyanate |
مترادف |
4-Isocyanatodiphenyl ether; 1-isocyanato-4-phenoxybenzene |
میدان مغناطیسی |
C13H9NO2 |
وزن مولکولی |
211.2161 |
InChI |
InChI=1/C13H9NO2/c15-10-14-11-6-8-13(9-7-11)16-12-4-2-1-3-5-12/h1-9H |
شماره سیایاس |
59377-19-4 |
ساختار مولکولی |
|
تراکم |
1.09g/cm3 |
نقطه غلیان |
307.4°C at 760 mmHg |
ضریب شکست |
1.561 |
نقطه اشتعال |
136°C |
کدهای خطر |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|