product Name |
4-Methoxy-1-naphthonitrile |
Synonyms |
1-Cyano-4-methoxynaphtalene; 1-Cyano-4-methoxynaphthalene; 4-methoxynaphthalene-1-carbonitrile |
Molecular Formula |
C12H9NO |
Molecular Weight |
183.206 |
InChI |
InChI=1/C12H9NO/c1-14-12-7-6-9(8-13)10-4-2-3-5-11(10)12/h2-7H,1H3 |
CAS Registry Number |
5961-55-7 |
EINECS |
227-734-6 |
Molecular Structure |
|
Density |
1.16g/cm3 |
Melting point |
99-102℃ |
Boiling point |
364.6°C at 760 mmHg |
Refractive index |
1.622 |
Flash point |
153.7°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|