product Name |
Diethyl oxalpropionate |
Synonyms |
Diethyl 2-methyl-2-oxosuccinate; Diethyl oxalpropionate;
; diethyl 2-oxopentanedioate; ethyl propyl carbonate |
Molecular Formula |
C6H12O3 |
Molecular Weight |
132.1577 |
InChI |
InChI=1/C6H12O3/c1-3-5-9-6(7)8-4-2/h3-5H2,1-2H3 |
CAS Registry Number |
5965-53-7 |
EINECS |
227-750-3 |
Molecular Structure |
|
Density |
0.961g/cm3 |
Boiling point |
139.3°C at 760 mmHg |
Refractive index |
1.4 |
Flash point |
48.3°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|