اسم المنتج |
2,2-dichloroethanol |
الاسم المستعار |
2,2-Dichloroethanol; 4-01-00-01383 (Beilstein Handbook Reference); BRN 1731633; Dichloroethanol; NSC 60513; Ethanol, 2,2-dichloro- |
الصيغة الجزيئية |
C2H4Cl2O |
الوزن الجزيئي الغرامي |
114.9586 |
InChI |
InChI=1/C2H4Cl2O/c3-2(4)1-5/h2,5H,1H2 |
إستراتيجية المساعدة القطرية |
598-38-9 |
المفوضية الأوروبية رقم |
209-931-9 |
بنية جزيئية |
|
كثافة |
1.398g/cm3 |
نقطة الغليان |
146°C at 760 mmHg |
معامل الإنكسار |
1.459 |
نقطة الوميض |
78.3°C |
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R40:Possible risks of irreversible effects.;
|
شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|