Название продукта |
3-Bromo-2,5-dichlorothiophene |
Молекулярная формула |
C4HBrCl2S |
Молекулярный вес |
231.9257 |
InChI |
InChI=1/C4HBrCl2S/c5-2-1-3(6)8-4(2)7/h1H |
Регистрационный номер CAS |
60404-18-4 |
Молекулярная структура |
|
Плотность |
1.949g/cm3 |
Точка кипения |
223.1°C at 760 mmHg |
Показатель преломления |
1.625 |
Температура вспышки |
88.7°C |
Риск коды |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Характеристики безопасности |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|