상품명칭 |
2-Bromo-2',4'-dimethoxyacetophenone |
별명 |
2-Bromo-2,4-dimethoxyacetophenone; 2-bromo-1-(2,4-dimethoxyphenyl)ethanone |
분자식 |
C10H11BrO3 |
분자량 |
259.0965 |
InChI |
InChI=1/C10H11BrO3/c1-13-7-3-4-8(9(12)6-11)10(5-7)14-2/h3-5H,6H2,1-2H3 |
cas번호 |
60965-26-6 |
EC번호 |
262-542-6 |
분자 구조 |
|
밀도 |
1.422g/cm3 |
녹는 점 |
101-105℃ |
비등점 |
348.2°C at 760 mmHg |
굴절 지수 |
1.542 |
인화점 |
164.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|