product Name |
exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic anhydride |
Synonyms |
5,6-Dehydronorcantharidin; exo-7-Oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic anhydride; (3aR,4S,7R,7aS)-3a,4,7,7a-tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione |
Molecular Formula |
C8H6O4 |
Molecular Weight |
166.1308 |
InChI |
InChI=1/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H/t3-,4+,5-,6+ |
CAS Registry Number |
6118-51-0 |
Molecular Structure |
|
Density |
1.54g/cm3 |
Melting point |
118℃ |
Boiling point |
372°C at 760 mmHg |
Refractive index |
1.583 |
Flash point |
172.3°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|