Produkt-Name |
2,5-Dihydroxy-1,4-benzoquinone |
Synonyme |
2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
Molekulare Formel |
C6H4O4 |
Molecular Weight |
140.0936 |
InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
CAS Registry Number |
615-94-1 |
EINECS |
210-454-3 |
Molecular Structure |
|
Dichte |
1.843g/cm3 |
Schmelzpunkt |
220℃ |
Siedepunkt |
322.3°C at 760 mmHg |
Brechungsindex |
1.729 |
Flammpunkt |
162.9°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|