product Name |
Methyl pyrazine-2-carboxylate |
Synonyms |
Methyl pyrazinecarboxylate; Pyrazinecarboxylic acid methyl ester; Methyl pyrazinoate; Pyrazinecarboxylic acid methyl ester; Methyl 2-Pyrazinecarboxylate |
Molecular Formula |
C6H6N2O2 |
Molecular Weight |
138.124 |
InChI |
InChI=1/C6H6N2O2/c1-10-6(9)5-4-7-2-3-8-5/h2-4H,1H3 |
CAS Registry Number |
6164-79-0 |
EINECS |
228-198-6 |
Molecular Structure |
|
Density |
1.213g/cm3 |
Melting point |
57-59℃ |
Boiling point |
220.4°C at 760 mmHg |
Refractive index |
1.513 |
Flash point |
87.1°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|