termék neve |
Benzoyl bromide |
MF |
C7H5BrO |
Molekulatömeg |
185.018 |
InChI |
InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
CAS-szám |
618-32-6 |
EINECS |
210-544-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.572g/cm3 |
Olvadáspont |
-24℃ |
Forráspont |
218.5°C at 760 mmHg |
Törésmutató |
1.584 |
Gyulladáspont |
89.7°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S25:Avoid contact with eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|