Nama produk |
4-hydroxy-3,5-diiodobenzoic acid |
Sinonim |
3,5-Diiodo-4-hydroxybenzoic acid |
MF |
C7H4I2O3 |
Berat Molekul |
389.9138 |
InChI |
InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
CAS NO |
618-76-8 |
EINECS |
210-562-0 |
Struktur Molekul |
|
Kepadatan |
2.697g/cm3 |
Titik didih |
346.4°C at 760 mmHg |
Indeks bias |
1.784 |
Titik nyala |
163.3°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|