نام محصول |
3-Nitrobenzhydrazide |
مترادف |
3-nitrobenzohydrazide; m-Nitrobenzhydrazide |
میدان مغناطیسی |
C7H7N3O3 |
وزن مولکولی |
181.1488 |
InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
شماره سیایاس |
618-94-0 |
تعداد کمیسیون اروپایی |
210-572-5 |
ساختار مولکولی |
|
تراکم |
1.406g/cm3 |
نقطه ذوب |
153-154℃ |
ضریب شکست |
1.621 |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|