Naam product |
6-chlorobenzo[d]isoxazol-3-ol |
Synoniemen |
6-Chloro-3-hydroxy-1,2-benzisoxazole; 6-chloro-1,2-benzisoxazol-3(2H)-one |
MF |
C7H4ClNO2 |
Molecuulgewicht |
169.5652 |
InChI |
InChI=1/C7H4ClNO2/c8-4-1-2-5-6(3-4)11-9-7(5)10/h1-3H,(H,9,10) |
CAS-nummer |
61977-29-5 |
Moleculaire Structuur |
|
Dichtheid |
1.486g/cm3 |
Smeltpunt |
218℃ |
Kookpunt |
336.7°C at 760 mmHg |
Brekingsindex |
1.603 |
Vlampunt |
157.4°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|