Ürün Adı |
4-Nitrophenyl phenyl ether |
Eş anlamlı |
p-Nitrodiphenyl ether; P-NITRODIPHENYLETHER; 1-nitro-4-phenoxybenzene; methyl 2-[(chloroacetyl)amino]benzoate; 2-chloro-N-(2-fluorophenyl)acetamide; 2-chloro-1-[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]ethanone |
Moleküler Formülü |
C15H16ClNO |
Molekül Ağırlığı |
261.7466 |
InChI |
InChI=1/C15H16ClNO/c1-10-4-6-13(7-5-10)17-11(2)8-14(12(17)3)15(18)9-16/h4-8H,9H2,1-3H3 |
CAS kayıt numarası |
620-88-2 |
EINECS |
210-656-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.12g/cm3 |
Ergime noktası |
53-56℃ |
Kaynama noktası |
399.6°C at 760 mmHg |
Kırılma indisi |
1.564 |
Alevlenme noktası |
195.4°C |
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|