Nome do produto |
1-Ethyl-3-phenylurea |
Sinônimos |
N-Ethyl-N-phenylurea |
Fórmula molecular |
C9H12N2O |
Peso Molecular |
164.2044 |
InChI |
InChI=1/C9H12N2O/c1-2-10-9(12)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,10,11,12) |
CAS Registry Number |
621-04-5 |
Estrutura Molecular |
|
Densidade |
1.11g/cm3 |
Ponto de ebulição |
250.2°C at 760 mmHg |
índice de refração |
1.573 |
O ponto de inflamação |
102°C |
Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|