Nama produk |
3-Ethoxybenzoic acid |
Sinonim |
3-Ethoxy Benzoic Acid |
MF |
C9H10O3 |
Berat Molekul |
166.1739 |
InChI |
InChI=1/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
CAS NO |
621-51-2 |
EINECS |
210-690-7 |
Struktur Molekul |
|
Kepadatan |
1.166g/cm3 |
Titik lebur |
136-140℃ |
Titik didih |
305.7°C at 760 mmHg |
Indeks bias |
1.537 |
Titik nyala |
124.1°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|