produktnavn |
3-(3-Hydroxyphenyl)propionic acid |
Synonymer |
3-Hydroxyhydrocinnamic acid; 3-Hydroxyphenyl-propionic acid; 3-(3-hydroxyphenyl)propanoic acid |
Molekylær Formel |
C9H10O3 |
Molekylvekt |
166.1739 |
InChI |
InChI=1/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
CAS-nummer |
621-54-5 |
EINECS |
210-692-8 |
Molecular Structure |
|
Tetthet |
1.26g/cm3 |
Kokepunkt |
354.5°C at 760 mmHg |
Brytningsindeks |
1.58 |
Flammepunktet |
182.4°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|