Nome del prodotto |
1,4-dibenzyloxybenzene |
Sinonimi |
Dibenzyloxybenzene,98%; quinol dibenzyl ether; 1,4-Bis(phenylmethoxy)benzene; Hydroquinone dibenzyl ether; 1,4-bis(benzyloxy)benzene |
Formula molecolare |
C20H18O2 |
Peso Molecolare |
290.3557 |
InChI |
InChI=1/C20H18O2/c1-3-7-17(8-4-1)15-21-19-11-13-20(14-12-19)22-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
Numero CAS |
621-91-0 |
EINECS |
210-714-6 |
Struttura molecolare |
|
Densità |
1.121g/cm3 |
Punto di ebollizione |
441.7°C at 760 mmHg |
Indice di rifrazione |
1.6 |
Punto d'infiammabilità |
173.4°C |
Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|