product Name |
Phenyl carbamate |
Synonyms |
AI3-50866; CCRIS 5071; NSC 66509; Carbamic acid, phenyl ester |
Molecular Formula |
C7H7NO2 |
Molecular Weight |
137.136 |
InChI |
InChI=1/C7H7NO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
CAS Registry Number |
622-46-8 |
EINECS |
210-737-1 |
Molecular Structure |
|
Density |
1.2g/cm3 |
Melting point |
145-152℃ |
Boiling point |
278.9°C at 760 mmHg |
Refractive index |
1.551 |
Flash point |
159.3°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|