product Name |
Cyclopropanecarboxamide |
Synonyms |
AI3-62011; Carbamoylcyclopropane; Cyclopropylcarboxamide; NSC 402033 |
Molecular Formula |
C4H7NO |
Molecular Weight |
85.1045 |
InChI |
InChI=1/C4H7NO/c5-4(6)3-1-2-3/h3H,1-2H2,(H2,5,6) |
CAS Registry Number |
6228-73-5 |
EINECS |
228-332-3 |
Molecular Structure |
|
Density |
1.187g/cm3 |
Boiling point |
248.5°C at 760 mmHg |
Refractive index |
1.524 |
Flash point |
104.1°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|