product Name |
Ibandronate Intermediate |
Synonyms |
3-(N-methylpentylamino)propionic acid hcl (intermediate of diphosphonate); INTERMEDIATE OF IBANDRONATE SODIUM; 3-(N-methylpentylamino)propionic acid; 3-(N-Methylpentylamino)propionic acid hydrochloride; 3-(1-methylpentylamino)propanoic acid hydrochloride; 3-(N-methylpentylamino)Propionic Acid HCL; 3-(N-Methyl-N-Pentylamino) Propionic Acid hydrochloride |
Molecular Formula |
C9H20ClNO2 |
Molecular Weight |
209.7136 |
InChI |
InChI=1/C9H19NO2.ClH/c1-3-4-5-8(2)10-7-6-9(11)12;/h8,10H,3-7H2,1-2H3,(H,11,12);1H |
CAS Registry Number |
625120-81-2 |
Molecular Structure |
|
Boiling point |
314.2°C at 760 mmHg |
Flash point |
143.8°C |
|