Naam product |
Fast Blue RR |
Synoniemen |
C.I. Azoic Diazo Component 24; Benzamide, N-(4-amino-2,5-dimethoxyphenyl)-; 4-Amino-2,5-dimethoxybenzanilide; Azoic Diazo No.24; Fast Blue Rr Base; Azoic Diazo Component 24 (37155); N-(4-amino-2,5-dimethoxyphenyl)benzamide |
MF |
C15H16N2O3 |
Molecuulgewicht |
272.2991 |
InChI |
InChI=1/C15H16N2O3/c1-19-13-9-12(14(20-2)8-11(13)16)17-15(18)10-6-4-3-5-7-10/h3-9H,16H2,1-2H3,(H,17,18) |
CAS-nummer |
6268-05-9 |
EINECS |
228-441-6 |
Moleculaire Structuur |
|
Dichtheid |
1.245g/cm3 |
Smeltpunt |
165-168℃ |
Kookpunt |
378.2°C at 760 mmHg |
Brekingsindex |
1.636 |
Vlampunt |
182.5°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|