상품명칭 |
4-Ethylphenylboronic acid |
별명 |
4-Ethylbenzeneboronic acid; P-Ethylphenylboronic acid; 4-Ethylphenyl boronic acid |
분자식 |
C8H11BO2 |
분자량 |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
cas번호 |
63139-21-9 |
분자 구조 |
|
밀도 |
1.07g/cm3 |
녹는 점 |
150-155℃ |
비등점 |
285.1°C at 760 mmHg |
굴절 지수 |
1.521 |
인화점 |
126.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|