상품명칭 |
5-aminobenzene-1,3-diol hydrochloride |
별명 |
5-aminobenzene-1,3-diol; 5-aminobenzene-1,3-diol hydrochloride (1:1) |
분자식 |
C6H8ClNO2 |
분자량 |
161.5862 |
InChI |
InChI=1/C6H7NO2.ClH/c7-4-1-5(8)3-6(9)2-4;/h1-3,8-9H,7H2;1H |
cas번호 |
6318-56-5 |
분자 구조 |
|
녹는 점 |
182℃ |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|