Produkt-Name |
6-Chloro-2,4-dimethixypyrimidine |
Synonyme |
6-Chloro-2,4-dimethoxypyrimidine; 4-chloro-2,6-dimethoxypyrimidine |
Molekulare Formel |
C6H7ClN2O2 |
Molecular Weight |
174.585 |
InChI |
InChI=1/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 |
CAS Registry Number |
6320-15-6 |
EINECS |
228-669-6 |
Molecular Structure |
|
Dichte |
1.285g/cm3 |
Schmelzpunkt |
74-76℃ |
Siedepunkt |
280.6°C at 760 mmHg |
Brechungsindex |
1.51 |
Flammpunkt |
123.5°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|