produktnavn |
4,5-Dibromothiophene-2-carboxylic acid |
Synonymer |
4,5-Dibromothenoic acid |
Molekylær Formel |
C5H2Br2O2S |
Molekylvekt |
285.9412 |
InChI |
InChI=1/C5H2Br2O2S/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) |
CAS-nummer |
6324-10-3 |
EINECS |
228-683-2 |
Molecular Structure |
|
Tetthet |
2.309g/cm3 |
Kokepunkt |
367.1°C at 760 mmHg |
Brytningsindeks |
1.682 |
Flammepunktet |
175.8°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|