Nama produk |
(2-hydroxyphenoxy)acetic acid |
Sinonim |
2-Hydroxyphenoxyacetic acid |
MF |
C8H8O4 |
Berat Molekul |
168.1467 |
InChI |
InChI=1/C8H8O4/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,9H,5H2,(H,10,11) |
CAS NO |
6324-11-4 |
EINECS |
228-684-8 |
Struktur Molekul |
|
Kepadatan |
1.367g/cm3 |
Titik lebur |
138-141℃ |
Titik didih |
339.6°C at 760 mmHg |
Indeks bias |
1.581 |
Titik nyala |
143°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|