Nome do produto |
1,4-Anthraquinone |
Sinônimos |
1,4-Dioxoanthracene; 1,4-Anthracenedione; anthracene-1,4-dione |
Fórmula molecular |
C14H8O2 |
Peso Molecular |
208.2121 |
InChI |
InChI=1/C14H8O2/c15-13-5-6-14(16)12-8-10-4-2-1-3-9(10)7-11(12)13/h1-8H |
CAS Registry Number |
635-12-1 |
EINECS |
211-228-7 |
Estrutura Molecular |
|
Densidade |
1.328g/cm3 |
Ponto de ebulição |
406°C at 760 mmHg |
índice de refração |
1.702 |
O ponto de inflamação |
152°C |
Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|