product Name |
Triethylamine hydrobromide |
Synonyms |
triethylammonium bromide |
Molecular Formula |
C6H15N.HBr |
Molecular Weight |
182.10 |
InChI |
InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
CAS Registry Number |
636-70-4 |
EINECS |
211-263-8 |
Molecular Structure |
|
Melting point |
246-248℃ |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|