product Name |
Tetrahydrofurfuryl acetate |
Synonyms |
Acetic acid tetrahydrofurfuryl ester; Tetrahydro-2-furanmethanol acetate; (2R)-tetrahydrofuran-2-ylmethyl acetate; (2S)-tetrahydrofuran-2-ylmethyl acetate |
Molecular Formula |
C7H12O3 |
Molecular Weight |
144.1684 |
InChI |
InChI=1/C7H12O3/c1-6(8)10-5-7-3-2-4-9-7/h7H,2-5H2,1H3/t7-/m0/s1 |
CAS Registry Number |
637-64-9 |
EINECS |
211-296-8 |
Molecular Structure |
|
Density |
1.049g/cm3 |
Boiling point |
205.5°C at 760 mmHg |
Refractive index |
1.434 |
Flash point |
84.4°C |
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|