product Name |
Bemegride |
Synonyms |
3-Ethyl-3-methylglutarimide; 4-Ethyl-4-methyl-2,6-piperidinedione; 3-Methyl-3-ethylglutarimide; 4-ethyl-4-methylpiperidine-2,6-dione |
Molecular Formula |
C8H13NO2 |
Molecular Weight |
155.1943 |
InChI |
InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
CAS Registry Number |
64-65-3 |
EINECS |
200-588-0 |
Molecular Structure |
|
Density |
1.024g/cm3 |
Melting point |
126-129℃ |
Boiling point |
282°C at 760 mmHg |
Refractive index |
1.448 |
Flash point |
125.8°C |
Hazard Symbols |
T:Toxic;
|
Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|