상품명칭 |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile |
별명 |
1-(4-Chlorophenyl)cyclohexanecarbonitrile |
분자식 |
C13H14ClN |
분자량 |
219.71 |
InChI |
InChI=1/C13H14ClN/c14-12-6-4-11(5-7-12)13(10-15)8-2-1-3-9-13/h4-7H,1-3,8-9H2 |
cas번호 |
64399-28-6 |
EC번호 |
264-872-6 |
분자 구조 |
|
밀도 |
1.14g/cm3 |
녹는 점 |
88-92℃ |
비등점 |
350.5°C at 760 mmHg |
굴절 지수 |
1.559 |
인화점 |
143.5°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|