نام محصول |
4-Fluorophthalonitrile |
مترادف |
4-Fluorophthalodinitrile; 1,2-Dicyano-4-Fluorobenzene; 4-Fluorobenzene-1,2-Dicarbonitrile; 4-fluoro-1,2-benzenedicarbonitrile; 4-fluoro-2-benzenedicarbonitrile; 1,2-Benzenedicarbonitrile,4-fluoro-; 4-Fluorobenzene-1,2-dicarbonitrile; 4-Fluorobenzene-1,2-dinitrile |
میدان مغناطیسی |
C8H3FN2 |
وزن مولکولی |
146.1212 |
InChI |
InChI=1/C8H3FN2/c9-8-2-1-6(4-10)7(3-8)5-11/h1-3H |
شماره سیایاس |
65610-14-2 |
ساختار مولکولی |
|
تراکم |
1.27g/cm3 |
نقطه ذوب |
100-102℃ |
نقطه غلیان |
303.7°C at 760 mmHg |
ضریب شکست |
1.538 |
نقطه اشتعال |
137.5°C |
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|