produktnavn |
7-Benzoylheptanoic acid |
Synonymer |
8-Oxo-8-phenyloctanoic acid |
Molekylær Formel |
C14H18O3 |
Molekylvekt |
234.2909 |
InChI |
InChI=1/C14H18O3/c15-13(12-8-4-3-5-9-12)10-6-1-2-7-11-14(16)17/h3-5,8-9H,1-2,6-7,10-11H2,(H,16,17) |
CAS-nummer |
66147-75-9 |
Molecular Structure |
|
Tetthet |
1.091g/cm3 |
Kokepunkt |
407.1°C at 760 mmHg |
Brytningsindeks |
1.523 |
Flammepunktet |
214.2°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|