Ονομασία του προϊόντος |
2-Nitrobenzaldoxime |
Συνώνυμα |
2-Nitrobenzaldoxime, (2-Nitrobenzaldehyde oxime); 2-Nitrobenzaldehyde oxime; N-hydroxy-1-(2-nitrophenyl)methanimine |
MF |
C7H6N2O3 |
Μοριακό βάρος |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-8-5-6-3-1-2-4-7(6)9(11)12/h1-5,10H/b8-5- |
CAS ΟΧΙ |
6635-41-2 |
EINECS |
229-634-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.33g/cm3 |
Σημείο τήξης |
98-100℃ |
Σημείο βρασμού |
305.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.589 |
Σημείο ανάφλεξης |
138.4°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|