Nazwa produktu: |
2,3-Dihydroxy-6-chloroquinoxaline |
Synonimy |
|
MF |
C8H5ClN2O2 |
Masie cząsteczkowej |
196.59 |
InChI |
InChI=1/C8H5ClN2O2/c9-4-1-2-5-6(3-4)11-8(13)7(12)10-5/h1-3H,(H,10,12)(H,11,13) |
Nr CAS |
6639-79-8 |
EINECS |
229-647-9 |
Struktury molekularnej |
|
Temperatura topnienia |
250℃ |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|