produktnavn |
5-Benzyloxyindole-2-carboxylic acid |
Synonymer |
5-(Benzyloxy)-1H-indole-2-carboxylic acid |
Molekylær Formel |
C16H13NO3 |
Molekylvekt |
267.2793 |
InChI |
InChI=1/C16H13NO3/c18-16(19)15-9-12-8-13(6-7-14(12)17-15)20-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,18,19) |
CAS-nummer |
6640-09-1 |
EINECS |
229-652-6 |
Molecular Structure |
|
Tetthet |
1.342g/cm3 |
Smeltepunkt |
192℃ |
Kokepunkt |
531.1°C at 760 mmHg |
Brytningsindeks |
1.696 |
Flammepunktet |
275°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|