Nama produk |
methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate |
Sinonim |
4-Formyl-2-methoxycarbonyl-N-methylpyrrole; methyl 4-formyl-1H-pyrrole-2-carboxylate |
MF |
C8H9NO3 |
Berat Molekul |
167.162 |
InChI |
InChI=1/C8H9NO3/c1-9-4-6(5-10)3-7(9)8(11)12-2/h3-5H,1-2H3 |
CAS NO |
67858-47-3 |
Struktur Molekul |
|
Kepadatan |
1.16g/cm3 |
Titik lebur |
96℃ |
Titik didih |
293.1°C at 760 mmHg |
Indeks bias |
1.521 |
Titik nyala |
131.1°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|