product Name |
7-methoxy-1-tetralone |
Synonyms |
7-methoxy-1,2,3,4-tetrahydronaphthalen-1-one; 7-methoxyl-1-tetralone; 7-methoxy-3,4-dihydronaphthalen-1(2H)-one; 3,4-Dihydro-7-methoxy-1(2H)-naphthalenone; 7-Methoxy-1-Tetralone |
Molecular Formula |
C11H12O2 |
Molecular Weight |
176.2118 |
InChI |
InChI=1/C11H12O2/c1-13-9-6-5-8-3-2-4-11(12)10(8)7-9/h5-7H,2-4H2,1H3 |
CAS Registry Number |
6836-19-7;6386-19-7 |
EINECS |
229-916-0 |
Molecular Structure |
|
Density |
1.124g/cm3 |
Melting point |
59-63℃ |
Boiling point |
312.3°C at 760 mmHg |
Refractive index |
1.548 |
Flash point |
145.8°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|