dipentene fluka spec. purified fraction of terpene hydrocarb

상품명칭	dipentene fluka spec. purified fraction of terpene hydrocarb
별명	Dipentene Fluka specially purified fraction of terpene hydrocarbons; DIPENTENE EXTRA; 1-methyl-4-(propan-2-yl)cyclohexa-1,3-diene; Dipentene
분자식	C₁₀H₁₆
분자량	136.234
InChI	InChI=1/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3
cas번호	68956-56-9
EC번호	273-309-3
분자 구조	$68956-56-9 dipentene fluka spec. purified fraction of terpene hydrocarb$
밀도	0.845g/cm³
비등점	174.1°C at 760 mmHg
굴절 지수	1.475
인화점	46.1°C
위험성 표시	Xi:Irritant; N:Dangerous for the environment;
리스크 규칙	R10:; R38:; R43:; R50/53:; R65:;
보안 규칙	S2:; S24:; S37:; S60:; S61:;