اسم المنتج |
2-Ethoxycinnamic acid |
الاسم المستعار |
(2E)-3-(2-ethoxyphenyl)prop-2-enoic acid |
الصيغة الجزيئية |
C11H12O3 |
الوزن الجزيئي الغرامي |
192.2112 |
InChI |
InChI=1/C11H12O3/c1-2-14-10-6-4-3-5-9(10)7-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)/b8-7+ |
إستراتيجية المساعدة القطرية |
69038-81-9 |
بنية جزيئية |
|
كثافة |
1.161g/cm3 |
درجة الإنصهار |
134-138℃ |
نقطة الغليان |
337.2°C at 760 mmHg |
معامل الإنكسار |
1.579 |
نقطة الوميض |
131.7°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|