उत्पाद का नाम |
1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle |
समानार्थी |
1,4-Cyclohexanedione mono-2,2-dimethyltrimethylene ketal; 3,3-dimethyl-1,5-dioxaspiro(5.5)undecan-9-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-8-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-9-one; 1,4-Cyclohexanedione Mono(2,2-Dimethyltrimethylene Ketal) |
आणविक फार्मूला |
C11H18O3 |
आण्विक वजन |
198.2588 |
InChI |
InChI=1/C11H18O3/c1-10(2)7-13-11(14-8-10)5-3-9(12)4-6-11/h3-8H2,1-2H3 |
कैस रजिस्टी संख्या |
69225-59-8 |
EINECS |
273-918-4 |
आणविक संरचना |
|
घनत्व |
1.08g/cm3 |
गलनांक |
45-50℃ |
उबलने का समय |
295.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.484 |
फ्लैश प्वाइंट |
123.3°C |
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|