상품명칭 |
5-(4-Methoxyphenyl)-1H-tetrazole |
별명 |
5-(4-methoxyphenyl)-2H-tetrazole |
분자식 |
C8H8N4O |
분자량 |
176.1753 |
InChI |
InChI=1/C8H8N4O/c1-13-7-4-2-6(3-5-7)8-9-11-12-10-8/h2-5H,1H3,(H,9,10,11,12) |
cas번호 |
6926-51-8 |
분자 구조 |
|
밀도 |
1.288g/cm3 |
비등점 |
365.2°C at 760 mmHg |
굴절 지수 |
1.591 |
인화점 |
133.2°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|