상품명칭 |
Methyl 2-aminopyridine-4-carboxylate |
별명 |
2-Aminopyridinecarboxylic acid methyl ester; Methyl 2-aminoisonicotinate; 2-Aminopyridine-4-carboxylic acid methyl ester; 2-aminopyridinecarboxylic acid methyl ester; methyl 2-aminoisonicotinate, (2-Amino-4-pyridinecarboxylic acid methylester); Methyl 2-Amino-4-pyridinecarboxylate; 2-Amino-isonicotinic acid methyl ester; 2-Aminoisonicotinic acid methyl ester |
분자식 |
C7H8N2O2 |
분자량 |
152.1506 |
InChI |
InChI=1/C7H8N2O2/c1-11-7(10)5-2-3-9-6(8)4-5/h2-4H,1H3,(H2,8,9) |
cas번호 |
6937-03-7 |
분자 구조 |
|
밀도 |
1.238g/cm3 |
비등점 |
296.1°C at 760 mmHg |
굴절 지수 |
1.57 |
인화점 |
132.9°C |
위험성 표시 |
Xi:;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|